C10H15ClN2O3S — CID 94133723
5-(chloromethyl)-2-methylsulfonyl-1-[[(2S)-oxolan-2-yl]methyl]imidazole (PubChem CID 94133723) has the molecular formula C10H15ClN2O3S and a molecular weight of 278.76 g/mol. Its IUPAC name is 5-(chloromethyl)-2-methylsulfonyl-1-[[(2S)-oxolan-2-yl]methyl]imidazole.
| Compound Name | 5-(chloromethyl)-2-methylsulfonyl-1-[[(2S)-oxolan-2-yl]methyl]imidazole |
|---|---|
| PubChem CID | 94133723 |
| Molecular Formula | C10H15ClN2O3S |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 5-(chloromethyl)-2-methylsulfonyl-1-[[(2S)-oxolan-2-yl]methyl]imidazole |
| SMILES | CS(=O)(=O)c1ncc(CCl)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C10H15ClN2O3S/c1-17(14,15)10-12-6-8(5-11)13(10)7-9-3-2-4-16-9/h6,9H,2-5,7H2,1H3/t9-/m0/s1 |
| InChIKey | OSUBWKCEQHUEEU-VIFPVBQESA-N |
| XLogP | 1.20 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|