C10H13ClN2O2 — CID 94145769
(4-chloro-1H-pyrrol-2-yl)-[(3R)-3-methylmorpholin-4-yl]methanone (PubChem CID 94145769) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is (4-chloro-1H-pyrrol-2-yl)-[(3R)-3-methylmorpholin-4-yl]methanone.
| Compound Name | (4-chloro-1H-pyrrol-2-yl)-[(3R)-3-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 94145769 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | (4-chloro-1H-pyrrol-2-yl)-[(3R)-3-methylmorpholin-4-yl]methanone |
| SMILES | C[C@@H]1COCCN1C(=O)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C10H13ClN2O2/c1-7-6-15-3-2-13(7)10(14)9-4-8(11)5-12-9/h4-5,7,12H,2-3,6H2,1H3/t7-/m1/s1 |
| InChIKey | WGWYKKJHGAGPBQ-SSDOTTSWSA-N |
| XLogP | 1.53 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |