C19H21ClN4O3 — CID 94146461
N'-(2-chlorobenzoyl)-6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridine-3-carbohydrazide (PubChem CID 94146461) has the molecular formula C19H21ClN4O3 and a molecular weight of 388.86 g/mol. Its IUPAC name is N'-(2-chlorobenzoyl)-6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-(2-chlorobenzoyl)-6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 94146461 |
| Molecular Formula | C19H21ClN4O3 |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N'-(2-chlorobenzoyl)-6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridine-3-carbohydrazide |
| SMILES | C[C@@H]1CN(c2ccc(C(=O)NNC(=O)c3ccccc3Cl)cn2)C[C@H](C)O1 |
| InChI | InChI=1S/C19H21ClN4O3/c1-12-10-24(11-13(2)27-12)17-8-7-14(9-21-17)18(25)22-23-19(26)15-5-3-4-6-16(15)20/h3-9,12-13H,10-11H2,1-2H3,(H,22,25)(H,23,26)/t12-,13+ |
| InChIKey | NPZHYOWNJBJZTI-BETUJISGSA-N |
| XLogP | 2.42 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|