About 2-(2,4-difluorophenyl)sulfonyl-1-[(2S)-2-methylmorpholin-4-yl]ethanone
2-(2,4-difluorophenyl)sulfonyl-1-[(2S)-2-methylmorpholin-4-yl]ethanone (PubChem CID 94151176) has the molecular formula C13H15F2NO4S
and a molecular weight of 319.33 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfonyl-1-[(2S)-2-methylmorpholin-4-yl]ethanone.
Molecular Properties
| Compound Name | 2-(2,4-difluorophenyl)sulfonyl-1-[(2S)-2-methylmorpholin-4-yl]ethanone |
| PubChem CID | 94151176 |
| Molecular Formula | C13H15F2NO4S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfonyl-1-[(2S)-2-methylmorpholin-4-yl]ethanone |
| SMILES | C[C@H]1CN(C(=O)CS(=O)(=O)c2ccc(F)cc2F)CCO1 |
| InChI | InChI=1S/C13H15F2NO4S/c1-9-7-16(4-5-20-9)13(17)8-21(18,19)12-3-2-10(14)6-11(12)15/h2-3,6,9H,4-5,7-8H2,1H3/t9-/m0/s1 |
| InChIKey | ZPGZBATXFMVQBI-VIFPVBQESA-N |
| XLogP | 0.99 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,4-difluorophenyl)sulfonyl-1-[(2S)-2-methylmorpholin-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-difluorophenyl)sulfonyl-1-[(2S)-2-methylmorpholin-4-yl]ethanone?
The IUPAC name of 2-(2,4-difluorophenyl)sulfonyl-1-[(2S)-2-methylmorpholin-4-yl]ethanone (CID 94151176) is 2-(2,4-difluorophenyl)sulfonyl-1-[(2S)-2-methylmorpholin-4-yl]ethanone.
What is the SMILES notation for 2-(2,4-difluorophenyl)sulfonyl-1-[(2S)-2-methylmorpholin-4-yl]ethanone?
The canonical SMILES for 2-(2,4-difluorophenyl)sulfonyl-1-[(2S)-2-methylmorpholin-4-yl]ethanone is C[C@H]1CN(C(=O)CS(=O)(=O)c2ccc(F)cc2F)CCO1.
What is the InChIKey of 2-(2,4-difluorophenyl)sulfonyl-1-[(2S)-2-methylmorpholin-4-yl]ethanone?
The InChIKey is ZPGZBATXFMVQBI-VIFPVBQESA-N. The full InChI is InChI=1S/C13H15F2NO4S/c1-9-7-16(4-5-20-9)13(17)8-21(18,19)12-3-2-10(14)6-11(12)15/h2-3,6,9H,4-5,7-8H2,1H3/t9-/m0/s1.
What are the key properties of 2-(2,4-difluorophenyl)sulfonyl-1-[(2S)-2-methylmorpholin-4-yl]ethanone?
2-(2,4-difluorophenyl)sulfonyl-1-[(2S)-2-methylmorpholin-4-yl]ethanone has a molecular weight of 319.33 g/mol, XLogP of 0.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-difluorophenyl)sulfonyl-1-[(2S)-2-methylmorpholin-4-yl]ethanone is sourced from PubChem (CID 94151176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).