C23H25N3O4 — CID 9415450
2-[3-[4-(2-ethoxyphenyl)piperazin-1-yl]-3-oxopropyl]isoindole-1,3-dione (PubChem CID 9415450) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-[3-[4-(2-ethoxyphenyl)piperazin-1-yl]-3-oxopropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-(2-ethoxyphenyl)piperazin-1-yl]-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 9415450 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[3-[4-(2-ethoxyphenyl)piperazin-1-yl]-3-oxopropyl]isoindole-1,3-dione |
| SMILES | CCOc1ccccc1N1CCN(C(=O)CCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C23H25N3O4/c1-2-30-20-10-6-5-9-19(20)24-13-15-25(16-14-24)21(27)11-12-26-22(28)17-7-3-4-8-18(17)23(26)29/h3-10H,2,11-16H2,1H3 |
| InChIKey | GGWSMCGUEQWQMG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|