C17H23N3O2S — CID 94156488
1-(1-acetylpiperidin-4-yl)-3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]urea (PubChem CID 94156488) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]urea.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]urea |
|---|---|
| PubChem CID | 94156488 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]urea |
| SMILES | CC(=O)N1CCC(NC(=O)N[C@@H]2CCSc3ccccc32)CC1 |
| InChI | InChI=1S/C17H23N3O2S/c1-12(21)20-9-6-13(7-10-20)18-17(22)19-15-8-11-23-16-5-3-2-4-14(15)16/h2-5,13,15H,6-11H2,1H3,(H2,18,19,22)/t15-/m1/s1 |
| InChIKey | JLQNXIBPBNEPQV-OAHLLOKOSA-N |
| XLogP | 2.53 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |