C16H23N3O2 — CID 94157322
N-(2-cyanoethyl)-2-[[(1S)-1-(2-methoxyphenyl)ethyl]-methylamino]-N-methylacetamide (PubChem CID 94157322) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[[(1S)-1-(2-methoxyphenyl)ethyl]-methylamino]-N-methylacetamide.
| Compound Name | N-(2-cyanoethyl)-2-[[(1S)-1-(2-methoxyphenyl)ethyl]-methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 94157322 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-(2-cyanoethyl)-2-[[(1S)-1-(2-methoxyphenyl)ethyl]-methylamino]-N-methylacetamide |
| SMILES | COc1ccccc1[C@H](C)N(C)CC(=O)N(C)CCC#N |
| InChI | InChI=1S/C16H23N3O2/c1-13(14-8-5-6-9-15(14)21-4)19(3)12-16(20)18(2)11-7-10-17/h5-6,8-9,13H,7,11-12H2,1-4H3/t13-/m0/s1 |
| InChIKey | CSGQRRUINMNHJF-ZDUSSCGKSA-N |
| XLogP | 2.06 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |