C17H23N3O5 — CID 94167830
methyl 2-[[2-[4-[[(2S)-2-methylmorpholine-4-carbonyl]amino]phenyl]acetyl]amino]acetate (PubChem CID 94167830) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is methyl 2-[[2-[4-[[(2S)-2-methylmorpholine-4-carbonyl]amino]phenyl]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[4-[[(2S)-2-methylmorpholine-4-carbonyl]amino]phenyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 94167830 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | methyl 2-[[2-[4-[[(2S)-2-methylmorpholine-4-carbonyl]amino]phenyl]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)Cc1ccc(NC(=O)N2CCO[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C17H23N3O5/c1-12-11-20(7-8-25-12)17(23)19-14-5-3-13(4-6-14)9-15(21)18-10-16(22)24-2/h3-6,12H,7-11H2,1-2H3,(H,18,21)(H,19,23)/t12-/m0/s1 |
| InChIKey | PHGLQECSXCQVKB-LBPRGKRZSA-N |
| XLogP | 0.77 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |