C17H20ClN3O3 — CID 94168240
(3R)-1-(4-chlorophenyl)-N-[2-(cyclopropanecarbonylamino)ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 94168240) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is (3R)-1-(4-chlorophenyl)-N-[2-(cyclopropanecarbonylamino)ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(4-chlorophenyl)-N-[2-(cyclopropanecarbonylamino)ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 94168240 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (3R)-1-(4-chlorophenyl)-N-[2-(cyclopropanecarbonylamino)ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCNC(=O)[C@@H]1CC(=O)N(c2ccc(Cl)cc2)C1)C1CC1 |
| InChI | InChI=1S/C17H20ClN3O3/c18-13-3-5-14(6-4-13)21-10-12(9-15(21)22)17(24)20-8-7-19-16(23)11-1-2-11/h3-6,11-12H,1-2,7-10H2,(H,19,23)(H,20,24)/t12-/m1/s1 |
| InChIKey | XFVDLHKMAXVLJD-GFCCVEGCSA-N |
| XLogP | 1.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|