C20H24N2O4S2 — CID 9416979
N-methyl-3-(4-methylphenyl)sulfonyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]propanamide (PubChem CID 9416979) has the molecular formula C20H24N2O4S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-methyl-3-(4-methylphenyl)sulfonyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]propanamide.
| Compound Name | N-methyl-3-(4-methylphenyl)sulfonyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 9416979 |
| Molecular Formula | C20H24N2O4S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-methyl-3-(4-methylphenyl)sulfonyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]propanamide |
| SMILES | CSc1ccccc1NC(=O)CN(C)C(=O)CCS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H24N2O4S2/c1-15-8-10-16(11-9-15)28(25,26)13-12-20(24)22(2)14-19(23)21-17-6-4-5-7-18(17)27-3/h4-11H,12-14H2,1-3H3,(H,21,23) |
| InChIKey | HRFNFQOZRIWEFW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |