C19H22N2O2S — CID 9417071
N,3,4-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]benzamide (PubChem CID 9417071) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is N,3,4-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]benzamide.
| Compound Name | N,3,4-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9417071 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N,3,4-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]benzamide |
| SMILES | CSc1ccccc1NC(=O)CN(C)C(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H22N2O2S/c1-13-9-10-15(11-14(13)2)19(23)21(3)12-18(22)20-16-7-5-6-8-17(16)24-4/h5-11H,12H2,1-4H3,(H,20,22) |
| InChIKey | WPMRJKINMOWLJV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |