C15H17N3O4S — CID 94172468
methyl (3R)-3-[(2-methoxy-3-pyridinyl)carbamoylamino]-3-thiophen-2-ylpropanoate (PubChem CID 94172468) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is methyl (3R)-3-[(2-methoxy-3-pyridinyl)carbamoylamino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl (3R)-3-[(2-methoxy-3-pyridinyl)carbamoylamino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 94172468 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | methyl (3R)-3-[(2-methoxy-3-pyridinyl)carbamoylamino]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)C[C@@H](NC(=O)Nc1cccnc1OC)c1cccs1 |
| InChI | InChI=1S/C15H17N3O4S/c1-21-13(19)9-11(12-6-4-8-23-12)18-15(20)17-10-5-3-7-16-14(10)22-2/h3-8,11H,9H2,1-2H3,(H2,17,18,20)/t11-/m1/s1 |
| InChIKey | NNSJVIIXIXLNMX-LLVKDONJSA-N |
| XLogP | 2.58 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |