C17H20N6O — CID 94174330
1-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-3-[(1R)-2,3-dihydro-1H-inden-1-yl]urea (PubChem CID 94174330) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is 1-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-3-[(1R)-2,3-dihydro-1H-inden-1-yl]urea.
| Compound Name | 1-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-3-[(1R)-2,3-dihydro-1H-inden-1-yl]urea |
|---|---|
| PubChem CID | 94174330 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 1-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-3-[(1R)-2,3-dihydro-1H-inden-1-yl]urea |
| SMILES | N#Cc1c(N)n[nH]c1CCCNC(=O)N[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C17H20N6O/c18-10-13-15(22-23-16(13)19)6-3-9-20-17(24)21-14-8-7-11-4-1-2-5-12(11)14/h1-2,4-5,14H,3,6-9H2,(H3,19,22,23)(H2,20,21,24)/t14-/m1/s1 |
| InChIKey | VHPNIVCEQAHGSN-CQSZACIVSA-N |
| XLogP | 1.78 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|