About 4-chloro-2-(2,4-difluorophenyl)-5-[(3R)-3-hydroxypiperidin-1-yl]pyridazin-3-one
4-chloro-2-(2,4-difluorophenyl)-5-[(3R)-3-hydroxypiperidin-1-yl]pyridazin-3-one (PubChem CID 94174563) has the molecular formula C15H14ClF2N3O2
and a molecular weight of 341.75 g/mol. Its IUPAC name is 4-chloro-2-(2,4-difluorophenyl)-5-[(3R)-3-hydroxypiperidin-1-yl]pyridazin-3-one.
Molecular Properties
| Compound Name | 4-chloro-2-(2,4-difluorophenyl)-5-[(3R)-3-hydroxypiperidin-1-yl]pyridazin-3-one |
| PubChem CID | 94174563 |
| Molecular Formula | C15H14ClF2N3O2 |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 4-chloro-2-(2,4-difluorophenyl)-5-[(3R)-3-hydroxypiperidin-1-yl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(N2CCC[C@@H](O)C2)cnn1-c1ccc(F)cc1F |
| InChI | InChI=1S/C15H14ClF2N3O2/c16-14-13(20-5-1-2-10(22)8-20)7-19-21(15(14)23)12-4-3-9(17)6-11(12)18/h3-4,6-7,10,22H,1-2,5,8H2/t10-/m1/s1 |
| InChIKey | UVMWUYFTUMHWQF-SNVBAGLBSA-N |
| XLogP | 2.13 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-2-(2,4-difluorophenyl)-5-[(3R)-3-hydroxypiperidin-1-yl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(2,4-difluorophenyl)-5-[(3R)-3-hydroxypiperidin-1-yl]pyridazin-3-one?
The IUPAC name of 4-chloro-2-(2,4-difluorophenyl)-5-[(3R)-3-hydroxypiperidin-1-yl]pyridazin-3-one (CID 94174563) is 4-chloro-2-(2,4-difluorophenyl)-5-[(3R)-3-hydroxypiperidin-1-yl]pyridazin-3-one.
What is the SMILES notation for 4-chloro-2-(2,4-difluorophenyl)-5-[(3R)-3-hydroxypiperidin-1-yl]pyridazin-3-one?
The canonical SMILES for 4-chloro-2-(2,4-difluorophenyl)-5-[(3R)-3-hydroxypiperidin-1-yl]pyridazin-3-one is O=c1c(Cl)c(N2CCC[C@@H](O)C2)cnn1-c1ccc(F)cc1F.
What is the InChIKey of 4-chloro-2-(2,4-difluorophenyl)-5-[(3R)-3-hydroxypiperidin-1-yl]pyridazin-3-one?
The InChIKey is UVMWUYFTUMHWQF-SNVBAGLBSA-N. The full InChI is InChI=1S/C15H14ClF2N3O2/c16-14-13(20-5-1-2-10(22)8-20)7-19-21(15(14)23)12-4-3-9(17)6-11(12)18/h3-4,6-7,10,22H,1-2,5,8H2/t10-/m1/s1.
What are the key properties of 4-chloro-2-(2,4-difluorophenyl)-5-[(3R)-3-hydroxypiperidin-1-yl]pyridazin-3-one?
4-chloro-2-(2,4-difluorophenyl)-5-[(3R)-3-hydroxypiperidin-1-yl]pyridazin-3-one has a molecular weight of 341.75 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2,4-difluorophenyl)-5-[(3R)-3-hydroxypiperidin-1-yl]pyridazin-3-one is sourced from PubChem (CID 94174563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).