C21H21N3O4 — CID 9417568
2-(1,4-dioxo-3H-phthalazin-2-yl)-N-methyl-N-[(4-prop-2-enoxyphenyl)methyl]acetamide (PubChem CID 9417568) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-(1,4-dioxo-3H-phthalazin-2-yl)-N-methyl-N-[(4-prop-2-enoxyphenyl)methyl]acetamide.
| Compound Name | 2-(1,4-dioxo-3H-phthalazin-2-yl)-N-methyl-N-[(4-prop-2-enoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 9417568 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-(1,4-dioxo-3H-phthalazin-2-yl)-N-methyl-N-[(4-prop-2-enoxyphenyl)methyl]acetamide |
| SMILES | C=CCOc1ccc(CN(C)C(=O)Cn2[nH]c(=O)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-3-12-28-16-10-8-15(9-11-16)13-23(2)19(25)14-24-21(27)18-7-5-4-6-17(18)20(26)22-24/h3-11H,1,12-14H2,2H3,(H,22,26) |
| InChIKey | VCGPRZVYZOWVSN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|