C14H15N3O2S — CID 94176221
(3S)-N-(6-methyl-1,3-benzothiazol-2-yl)-6-oxopiperidine-3-carboxamide (PubChem CID 94176221) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is (3S)-N-(6-methyl-1,3-benzothiazol-2-yl)-6-oxopiperidine-3-carboxamide.
| Compound Name | (3S)-N-(6-methyl-1,3-benzothiazol-2-yl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 94176221 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | (3S)-N-(6-methyl-1,3-benzothiazol-2-yl)-6-oxopiperidine-3-carboxamide |
| SMILES | Cc1ccc2nc(NC(=O)[C@H]3CCC(=O)NC3)sc2c1 |
| InChI | InChI=1S/C14H15N3O2S/c1-8-2-4-10-11(6-8)20-14(16-10)17-13(19)9-3-5-12(18)15-7-9/h2,4,6,9H,3,5,7H2,1H3,(H,15,18)(H,16,17,19)/t9-/m0/s1 |
| InChIKey | WZQGGFAZFAHDHY-VIFPVBQESA-N |
| XLogP | 2.07 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |