C16H20N3O2+ — CID 9417627
dimethyl-[3-[2-(naphthalene-2-carbonyl)hydrazinyl]-3-oxopropyl]azanium (PubChem CID 9417627) has the molecular formula C16H20N3O2+ and a molecular weight of 286.36 g/mol. Its IUPAC name is dimethyl-[3-[2-(naphthalene-2-carbonyl)hydrazinyl]-3-oxopropyl]azanium.
| Compound Name | dimethyl-[3-[2-(naphthalene-2-carbonyl)hydrazinyl]-3-oxopropyl]azanium |
|---|---|
| PubChem CID | 9417627 |
| Molecular Formula | C16H20N3O2+ |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | dimethyl-[3-[2-(naphthalene-2-carbonyl)hydrazinyl]-3-oxopropyl]azanium |
| SMILES | C[NH+](C)CCC(=O)NNC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H19N3O2/c1-19(2)10-9-15(20)17-18-16(21)14-8-7-12-5-3-4-6-13(12)11-14/h3-8,11H,9-10H2,1-2H3,(H,17,20)(H,18,21)/p+1 |
| InChIKey | FEUGOQSLBGNTSJ-UHFFFAOYSA-O |
| XLogP | 0.14 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|