C18H17N3O2 — CID 94178883
(3R)-3',5,7-trimethylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione (PubChem CID 94178883) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is (3R)-3',5,7-trimethylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione.
| Compound Name | (3R)-3',5,7-trimethylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione |
|---|---|
| PubChem CID | 94178883 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | (3R)-3',5,7-trimethylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione |
| SMILES | Cc1cc(C)c2c(c1)[C@]1(Nc3ccccc3C(=O)N1C)C(=O)N2 |
| InChI | InChI=1S/C18H17N3O2/c1-10-8-11(2)15-13(9-10)18(17(23)19-15)20-14-7-5-4-6-12(14)16(22)21(18)3/h4-9,20H,1-3H3,(H,19,23)/t18-/m1/s1 |
| InChIKey | ZMWLAEACUBMRML-GOSISDBHSA-N |
| XLogP | 2.61 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |