C9H17F3N2O4S — CID 94178902
(2S)-N-[2-(ethylsulfonylamino)ethyl]-2-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 94178902) has the molecular formula C9H17F3N2O4S and a molecular weight of 306.31 g/mol. Its IUPAC name is (2S)-N-[2-(ethylsulfonylamino)ethyl]-2-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | (2S)-N-[2-(ethylsulfonylamino)ethyl]-2-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 94178902 |
| Molecular Formula | C9H17F3N2O4S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (2S)-N-[2-(ethylsulfonylamino)ethyl]-2-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CCS(=O)(=O)NCCNC(=O)[C@H](C)OCC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O4S/c1-3-19(16,17)14-5-4-13-8(15)7(2)18-6-9(10,11)12/h7,14H,3-6H2,1-2H3,(H,13,15)/t7-/m0/s1 |
| InChIKey | SIASHKNHTPWIRS-ZETCQYMHSA-N |
| XLogP | 0.01 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|