C16H25N3O3 — CID 94178980
(2S)-2-[(2-methoxyphenyl)methylcarbamoylamino]-N,4-dimethylpentanamide (PubChem CID 94178980) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is (2S)-2-[(2-methoxyphenyl)methylcarbamoylamino]-N,4-dimethylpentanamide.
| Compound Name | (2S)-2-[(2-methoxyphenyl)methylcarbamoylamino]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 94178980 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (2S)-2-[(2-methoxyphenyl)methylcarbamoylamino]-N,4-dimethylpentanamide |
| SMILES | CNC(=O)[C@H](CC(C)C)NC(=O)NCc1ccccc1OC |
| InChI | InChI=1S/C16H25N3O3/c1-11(2)9-13(15(20)17-3)19-16(21)18-10-12-7-5-6-8-14(12)22-4/h5-8,11,13H,9-10H2,1-4H3,(H,17,20)(H2,18,19,21)/t13-/m0/s1 |
| InChIKey | VFNAGFHZERPGDG-ZDUSSCGKSA-N |
| XLogP | 1.66 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |