C18H25N5O2 — CID 94179278
1-cyclopropyl-1-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-3-[3-(1,2,4-triazol-1-yl)propyl]urea (PubChem CID 94179278) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-cyclopropyl-1-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-3-[3-(1,2,4-triazol-1-yl)propyl]urea.
| Compound Name | 1-cyclopropyl-1-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-3-[3-(1,2,4-triazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 94179278 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 1-cyclopropyl-1-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-3-[3-(1,2,4-triazol-1-yl)propyl]urea |
| SMILES | C[C@H]1C[C@@H]1c1ccc(CN(C(=O)NCCCn2cncn2)C2CC2)o1 |
| InChI | InChI=1S/C18H25N5O2/c1-13-9-16(13)17-6-5-15(25-17)10-23(14-3-4-14)18(24)20-7-2-8-22-12-19-11-21-22/h5-6,11-14,16H,2-4,7-10H2,1H3,(H,20,24)/t13-,16-/m0/s1 |
| InChIKey | NKGYFUXZBAZWPF-BBRMVZONSA-N |
| XLogP | 2.76 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|