C19H27N5O — CID 94180427
1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-[(2R)-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]ethanone (PubChem CID 94180427) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is 1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-[(2R)-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-[(2R)-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 94180427 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-[(2R)-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]ethanone |
| SMILES | C[C@@H]1C[C@H](C)CN(C(=O)CN2CCC[C@@H]2c2nnc3ccccn23)C1 |
| InChI | InChI=1S/C19H27N5O/c1-14-10-15(2)12-23(11-14)18(25)13-22-8-5-6-16(22)19-21-20-17-7-3-4-9-24(17)19/h3-4,7,9,14-16H,5-6,8,10-13H2,1-2H3/t14-,15+,16-/m1/s1 |
| InChIKey | XLHCYGKTCAMXJA-OWCLPIDISA-N |
| XLogP | 2.37 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |