C14H18N4S — CID 94181560
N-[(1R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 94181560) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is N-[(1R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(1R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 94181560 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-[(1R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | c1nc(N[C@@H]2CCN3CCCC[C@H]23)c2ccsc2n1 |
| InChI | InChI=1S/C14H18N4S/c1-2-6-18-7-4-11(12(18)3-1)17-13-10-5-8-19-14(10)16-9-15-13/h5,8-9,11-12H,1-4,6-7H2,(H,15,16,17)/t11-,12-/m1/s1 |
| InChIKey | VPYOQVZCKRQYCW-VXGBXAGGSA-N |
| XLogP | 2.73 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |