C19H26N2O2 — CID 94181986
N-[(2R)-butan-2-yl]-3-[[[(1S)-cyclohex-3-ene-1-carbonyl]amino]methyl]benzamide (PubChem CID 94181986) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-3-[[[(1S)-cyclohex-3-ene-1-carbonyl]amino]methyl]benzamide.
| Compound Name | N-[(2R)-butan-2-yl]-3-[[[(1S)-cyclohex-3-ene-1-carbonyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 94181986 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | N-[(2R)-butan-2-yl]-3-[[[(1S)-cyclohex-3-ene-1-carbonyl]amino]methyl]benzamide |
| SMILES | CC[C@@H](C)NC(=O)c1cccc(CNC(=O)[C@@H]2CC=CCC2)c1 |
| InChI | InChI=1S/C19H26N2O2/c1-3-14(2)21-19(23)17-11-7-8-15(12-17)13-20-18(22)16-9-5-4-6-10-16/h4-5,7-8,11-12,14,16H,3,6,9-10,13H2,1-2H3,(H,20,22)(H,21,23)/t14-,16-/m1/s1 |
| InChIKey | XJAASDGZUCRXRM-GDBMZVCRSA-N |
| XLogP | 3.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|