C16H18FNO4 — CID 94184974
(1S,6S)-6-[(2-ethoxy-4-fluorophenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 94184974) has the molecular formula C16H18FNO4 and a molecular weight of 307.32 g/mol. Its IUPAC name is (1S,6S)-6-[(2-ethoxy-4-fluorophenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6S)-6-[(2-ethoxy-4-fluorophenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 94184974 |
| Molecular Formula | C16H18FNO4 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (1S,6S)-6-[(2-ethoxy-4-fluorophenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCOc1cc(F)ccc1NC(=O)[C@H]1CC=CC[C@@H]1C(=O)O |
| InChI | InChI=1S/C16H18FNO4/c1-2-22-14-9-10(17)7-8-13(14)18-15(19)11-5-3-4-6-12(11)16(20)21/h3-4,7-9,11-12H,2,5-6H2,1H3,(H,18,19)(H,20,21)/t11-,12-/m0/s1 |
| InChIKey | SDCBULDXAHPAPW-RYUDHWBXSA-N |
| XLogP | 2.83 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|