C15H25N3O — CID 94186074
(E)-N-[(2S)-3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methylpent-2-enamide (PubChem CID 94186074) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is (E)-N-[(2S)-3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methylpent-2-enamide.
| Compound Name | (E)-N-[(2S)-3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methylpent-2-enamide |
|---|---|
| PubChem CID | 94186074 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | (E)-N-[(2S)-3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methylpent-2-enamide |
| SMILES | CC/C=C(\C)C(=O)NC[C@H](C)Cn1nc(C)cc1C |
| InChI | InChI=1S/C15H25N3O/c1-6-7-12(3)15(19)16-9-11(2)10-18-14(5)8-13(4)17-18/h7-8,11H,6,9-10H2,1-5H3,(H,16,19)/b12-7+/t11-/m0/s1 |
| InChIKey | BCXZXAPJOSIFKR-WBOGTDJTSA-N |
| XLogP | 2.61 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|