About (2R)-N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide
(2R)-N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide (PubChem CID 94186139) has the molecular formula C15H24N2O2S
and a molecular weight of 296.44 g/mol. Its IUPAC name is (2R)-N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide.
Molecular Properties
| Compound Name | (2R)-N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide |
| PubChem CID | 94186139 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (2R)-N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide |
| SMILES | Cc1nc(S[C@H](C)C(=O)NCC2CCCCC2)oc1C |
| InChI | InChI=1S/C15H24N2O2S/c1-10-11(2)19-15(17-10)20-12(3)14(18)16-9-13-7-5-4-6-8-13/h12-13H,4-9H2,1-3H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | MOGRLCVOHJDISS-GFCCVEGCSA-N |
| XLogP | 3.47 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide?
The IUPAC name of (2R)-N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide (CID 94186139) is (2R)-N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide.
What is the SMILES notation for (2R)-N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide?
The canonical SMILES for (2R)-N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide is Cc1nc(S[C@H](C)C(=O)NCC2CCCCC2)oc1C.
What is the InChIKey of (2R)-N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide?
The InChIKey is MOGRLCVOHJDISS-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H24N2O2S/c1-10-11(2)19-15(17-10)20-12(3)14(18)16-9-13-7-5-4-6-8-13/h12-13H,4-9H2,1-3H3,(H,16,18)/t12-/m1/s1.
What are the key properties of (2R)-N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide?
(2R)-N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide has a molecular weight of 296.44 g/mol, XLogP of 3.47, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide is sourced from PubChem (CID 94186139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).