C16H20F3NO3 — CID 94186944
N-ethyl-N-[[(3S)-oxolan-3-yl]methyl]-2-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 94186944) has the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. Its IUPAC name is N-ethyl-N-[[(3S)-oxolan-3-yl]methyl]-2-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-ethyl-N-[[(3S)-oxolan-3-yl]methyl]-2-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 94186944 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-ethyl-N-[[(3S)-oxolan-3-yl]methyl]-2-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | CCN(C[C@@H]1CCOC1)C(=O)Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H20F3NO3/c1-2-20(10-13-7-8-22-11-13)15(21)9-12-3-5-14(6-4-12)23-16(17,18)19/h3-6,13H,2,7-11H2,1H3/t13-/m0/s1 |
| InChIKey | TVKWJVUFBJAZHB-ZDUSSCGKSA-N |
| XLogP | 3.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |