About 5-[(3S)-oxolan-3-yl]-1,3,4-thiadiazol-2-amine
5-[(3S)-oxolan-3-yl]-1,3,4-thiadiazol-2-amine (PubChem CID 94191622) has the molecular formula C6H9N3OS
and a molecular weight of 171.22 g/mol. Its IUPAC name is 5-[(3S)-oxolan-3-yl]-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-[(3S)-oxolan-3-yl]-1,3,4-thiadiazol-2-amine |
| PubChem CID | 94191622 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 5-[(3S)-oxolan-3-yl]-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc([C@H]2CCOC2)s1 |
| InChI | InChI=1S/C6H9N3OS/c7-6-9-8-5(11-6)4-1-2-10-3-4/h4H,1-3H2,(H2,7,9)/t4-/m0/s1 |
| InChIKey | KDBWQQVBYCWRJV-BYPYZUCNSA-N |
| XLogP | 0.62 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(3S)-oxolan-3-yl]-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3S)-oxolan-3-yl]-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-[(3S)-oxolan-3-yl]-1,3,4-thiadiazol-2-amine (CID 94191622) is 5-[(3S)-oxolan-3-yl]-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-[(3S)-oxolan-3-yl]-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-[(3S)-oxolan-3-yl]-1,3,4-thiadiazol-2-amine is Nc1nnc([C@H]2CCOC2)s1.
What is the InChIKey of 5-[(3S)-oxolan-3-yl]-1,3,4-thiadiazol-2-amine?
The InChIKey is KDBWQQVBYCWRJV-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H9N3OS/c7-6-9-8-5(11-6)4-1-2-10-3-4/h4H,1-3H2,(H2,7,9)/t4-/m0/s1.
What are the key properties of 5-[(3S)-oxolan-3-yl]-1,3,4-thiadiazol-2-amine?
5-[(3S)-oxolan-3-yl]-1,3,4-thiadiazol-2-amine has a molecular weight of 171.22 g/mol, XLogP of 0.62, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3S)-oxolan-3-yl]-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 94191622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).