C13H13N3O3S2 — CID 94192056
N-(2,1,3-benzothiadiazol-4-ylsulfonyl)-2-[(1S)-cyclopent-2-en-1-yl]acetamide (PubChem CID 94192056) has the molecular formula C13H13N3O3S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-4-ylsulfonyl)-2-[(1S)-cyclopent-2-en-1-yl]acetamide.
| Compound Name | N-(2,1,3-benzothiadiazol-4-ylsulfonyl)-2-[(1S)-cyclopent-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 94192056 |
| Molecular Formula | C13H13N3O3S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-4-ylsulfonyl)-2-[(1S)-cyclopent-2-en-1-yl]acetamide |
| SMILES | O=C(C[C@H]1C=CCC1)NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C13H13N3O3S2/c17-12(8-9-4-1-2-5-9)16-21(18,19)11-7-3-6-10-13(11)15-20-14-10/h1,3-4,6-7,9H,2,5,8H2,(H,16,17)/t9-/m0/s1 |
| InChIKey | HOVIENSBFOEGBD-VIFPVBQESA-N |
| XLogP | 1.85 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|