C20H24N4O2 — CID 94193234
N-[(1R,2S)-2-methylcyclohexyl]-N'-[3-(2-methylpyrimidin-4-yl)phenyl]oxamide (PubChem CID 94193234) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[(1R,2S)-2-methylcyclohexyl]-N'-[3-(2-methylpyrimidin-4-yl)phenyl]oxamide.
| Compound Name | N-[(1R,2S)-2-methylcyclohexyl]-N'-[3-(2-methylpyrimidin-4-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 94193234 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-[(1R,2S)-2-methylcyclohexyl]-N'-[3-(2-methylpyrimidin-4-yl)phenyl]oxamide |
| SMILES | Cc1nccc(-c2cccc(NC(=O)C(=O)N[C@@H]3CCCC[C@@H]3C)c2)n1 |
| InChI | InChI=1S/C20H24N4O2/c1-13-6-3-4-9-17(13)24-20(26)19(25)23-16-8-5-7-15(12-16)18-10-11-21-14(2)22-18/h5,7-8,10-13,17H,3-4,6,9H2,1-2H3,(H,23,25)(H,24,26)/t13-,17+/m0/s1 |
| InChIKey | ZESWDYGTSWCUCQ-SUMWQHHRSA-N |
| XLogP | 3.09 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|