About trans-(1R,2R)-N'-pyrimidin-2-yl-2-(trifluoromethyl)cyclohexane-1-carbohydrazide
trans-(1R,2R)-N'-pyrimidin-2-yl-2-(trifluoromethyl)cyclohexane-1-carbohydrazide (PubChem CID 94193373) has the molecular formula C12H15F3N4O
and a molecular weight of 288.27 g/mol. Its IUPAC name is trans-(1R,2R)-N'-pyrimidin-2-yl-2-(trifluoromethyl)cyclohexane-1-carbohydrazide.
Molecular Properties
| Compound Name | trans-(1R,2R)-N'-pyrimidin-2-yl-2-(trifluoromethyl)cyclohexane-1-carbohydrazide |
| PubChem CID | 94193373 |
| Molecular Formula | C12H15F3N4O |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | trans-(1R,2R)-N'-pyrimidin-2-yl-2-(trifluoromethyl)cyclohexane-1-carbohydrazide |
| SMILES | O=C(NNc1ncccn1)[C@@H]1CCCC[C@H]1C(F)(F)F |
| InChI | InChI=1S/C12H15F3N4O/c13-12(14,15)9-5-2-1-4-8(9)10(20)18-19-11-16-6-3-7-17-11/h3,6-9H,1-2,4-5H2,(H,18,20)(H,16,17,19)/t8-,9-/m1/s1 |
| InChIKey | XEUAPKNCDLXUAI-RKDXNWHRSA-N |
| XLogP | 2.29 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2R)-N'-pyrimidin-2-yl-2-(trifluoromethyl)cyclohexane-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-N'-pyrimidin-2-yl-2-(trifluoromethyl)cyclohexane-1-carbohydrazide?
The IUPAC name of trans-(1R,2R)-N'-pyrimidin-2-yl-2-(trifluoromethyl)cyclohexane-1-carbohydrazide (CID 94193373) is trans-(1R,2R)-N'-pyrimidin-2-yl-2-(trifluoromethyl)cyclohexane-1-carbohydrazide.
What is the SMILES notation for trans-(1R,2R)-N'-pyrimidin-2-yl-2-(trifluoromethyl)cyclohexane-1-carbohydrazide?
The canonical SMILES for trans-(1R,2R)-N'-pyrimidin-2-yl-2-(trifluoromethyl)cyclohexane-1-carbohydrazide is O=C(NNc1ncccn1)[C@@H]1CCCC[C@H]1C(F)(F)F.
What is the InChIKey of trans-(1R,2R)-N'-pyrimidin-2-yl-2-(trifluoromethyl)cyclohexane-1-carbohydrazide?
The InChIKey is XEUAPKNCDLXUAI-RKDXNWHRSA-N. The full InChI is InChI=1S/C12H15F3N4O/c13-12(14,15)9-5-2-1-4-8(9)10(20)18-19-11-16-6-3-7-17-11/h3,6-9H,1-2,4-5H2,(H,18,20)(H,16,17,19)/t8-,9-/m1/s1.
What are the key properties of trans-(1R,2R)-N'-pyrimidin-2-yl-2-(trifluoromethyl)cyclohexane-1-carbohydrazide?
trans-(1R,2R)-N'-pyrimidin-2-yl-2-(trifluoromethyl)cyclohexane-1-carbohydrazide has a molecular weight of 288.27 g/mol, XLogP of 2.29, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-N'-pyrimidin-2-yl-2-(trifluoromethyl)cyclohexane-1-carbohydrazide is sourced from PubChem (CID 94193373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).