C13H16N2OS3 — CID 94194288
2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-[(1S)-1-thiophen-2-ylpropyl]acetamide (PubChem CID 94194288) has the molecular formula C13H16N2OS3 and a molecular weight of 312.49 g/mol. Its IUPAC name is 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-[(1S)-1-thiophen-2-ylpropyl]acetamide.
| Compound Name | 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-[(1S)-1-thiophen-2-ylpropyl]acetamide |
|---|---|
| PubChem CID | 94194288 |
| Molecular Formula | C13H16N2OS3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-[(1S)-1-thiophen-2-ylpropyl]acetamide |
| SMILES | CC[C@H](NC(=O)Cc1sc(=S)[nH]c1C)c1cccs1 |
| InChI | InChI=1S/C13H16N2OS3/c1-3-9(10-5-4-6-18-10)15-12(16)7-11-8(2)14-13(17)19-11/h4-6,9H,3,7H2,1-2H3,(H,14,17)(H,15,16)/t9-/m0/s1 |
| InChIKey | PPGXSYGAIBVPNY-VIFPVBQESA-N |
| XLogP | 3.99 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|