C12H13IN4O — CID 9419431
N-(2-ethylphenyl)-2-(3-iodo-1,2,4-triazol-1-yl)acetamide (PubChem CID 9419431) has the molecular formula C12H13IN4O and a molecular weight of 356.17 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-(3-iodo-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(2-ethylphenyl)-2-(3-iodo-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 9419431 |
| Molecular Formula | C12H13IN4O |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | N-(2-ethylphenyl)-2-(3-iodo-1,2,4-triazol-1-yl)acetamide |
| SMILES | CCc1ccccc1NC(=O)Cn1cnc(I)n1 |
| InChI | InChI=1S/C12H13IN4O/c1-2-9-5-3-4-6-10(9)15-11(18)7-17-8-14-12(13)16-17/h3-6,8H,2,7H2,1H3,(H,15,18) |
| InChIKey | WTVMDFHMGATGEX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|