C15H17N3O2 — CID 94195434
(2Z,4E)-N-[(1S)-1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]hexa-2,4-dienamide (PubChem CID 94195434) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is (2Z,4E)-N-[(1S)-1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]hexa-2,4-dienamide.
| Compound Name | (2Z,4E)-N-[(1S)-1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 94195434 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (2Z,4E)-N-[(1S)-1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C\C(=O)N[C@@H](C)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C15H17N3O2/c1-3-4-5-6-14(19)16-10(2)11-7-8-12-13(9-11)18-15(20)17-12/h3-10H,1-2H3,(H,16,19)(H2,17,18,20)/b4-3+,6-5-/t10-/m0/s1 |
| InChIKey | LWGCZAYLTIDMPB-JOWDJYSLSA-N |
| XLogP | 2.17 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|