About N-[(1S)-2,2-dimethyl-1-thiophen-2-ylpropyl]ethanesulfonamide
N-[(1S)-2,2-dimethyl-1-thiophen-2-ylpropyl]ethanesulfonamide (PubChem CID 94197142) has the molecular formula C11H19NO2S2
and a molecular weight of 261.41 g/mol. Its IUPAC name is N-[(1S)-2,2-dimethyl-1-thiophen-2-ylpropyl]ethanesulfonamide.
Molecular Properties
| Compound Name | N-[(1S)-2,2-dimethyl-1-thiophen-2-ylpropyl]ethanesulfonamide |
| PubChem CID | 94197142 |
| Molecular Formula | C11H19NO2S2 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-[(1S)-2,2-dimethyl-1-thiophen-2-ylpropyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N[C@H](c1cccs1)C(C)(C)C |
| InChI | InChI=1S/C11H19NO2S2/c1-5-16(13,14)12-10(11(2,3)4)9-7-6-8-15-9/h6-8,10,12H,5H2,1-4H3/t10-/m1/s1 |
| InChIKey | ANFHHOQSBVMUAN-SNVBAGLBSA-N |
| XLogP | 2.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1S)-2,2-dimethyl-1-thiophen-2-ylpropyl]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-2,2-dimethyl-1-thiophen-2-ylpropyl]ethanesulfonamide?
The IUPAC name of N-[(1S)-2,2-dimethyl-1-thiophen-2-ylpropyl]ethanesulfonamide (CID 94197142) is N-[(1S)-2,2-dimethyl-1-thiophen-2-ylpropyl]ethanesulfonamide.
What is the SMILES notation for N-[(1S)-2,2-dimethyl-1-thiophen-2-ylpropyl]ethanesulfonamide?
The canonical SMILES for N-[(1S)-2,2-dimethyl-1-thiophen-2-ylpropyl]ethanesulfonamide is CCS(=O)(=O)N[C@H](c1cccs1)C(C)(C)C.
What is the InChIKey of N-[(1S)-2,2-dimethyl-1-thiophen-2-ylpropyl]ethanesulfonamide?
The InChIKey is ANFHHOQSBVMUAN-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H19NO2S2/c1-5-16(13,14)12-10(11(2,3)4)9-7-6-8-15-9/h6-8,10,12H,5H2,1-4H3/t10-/m1/s1.
What are the key properties of N-[(1S)-2,2-dimethyl-1-thiophen-2-ylpropyl]ethanesulfonamide?
N-[(1S)-2,2-dimethyl-1-thiophen-2-ylpropyl]ethanesulfonamide has a molecular weight of 261.41 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-2,2-dimethyl-1-thiophen-2-ylpropyl]ethanesulfonamide is sourced from PubChem (CID 94197142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).