C17H20N2O2S — CID 94197249
N-[[4-[[(2R)-butan-2-yl]carbamoyl]phenyl]methyl]thiophene-3-carboxamide (PubChem CID 94197249) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-[[4-[[(2R)-butan-2-yl]carbamoyl]phenyl]methyl]thiophene-3-carboxamide.
| Compound Name | N-[[4-[[(2R)-butan-2-yl]carbamoyl]phenyl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 94197249 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[[4-[[(2R)-butan-2-yl]carbamoyl]phenyl]methyl]thiophene-3-carboxamide |
| SMILES | CC[C@@H](C)NC(=O)c1ccc(CNC(=O)c2ccsc2)cc1 |
| InChI | InChI=1S/C17H20N2O2S/c1-3-12(2)19-17(21)14-6-4-13(5-7-14)10-18-16(20)15-8-9-22-11-15/h4-9,11-12H,3,10H2,1-2H3,(H,18,20)(H,19,21)/t12-/m1/s1 |
| InChIKey | XFIHBXIYXMOUCS-GFCCVEGCSA-N |
| XLogP | 3.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |