C22H21ClN6O3 — CID 94199290
8-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-2-[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 94199290) has the molecular formula C22H21ClN6O3 and a molecular weight of 452.90 g/mol. Its IUPAC name is 8-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-2-[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 8-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-2-[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 94199290 |
| Molecular Formula | C22H21ClN6O3 |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 8-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-2-[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | C[C@@H]1CCCN(C(=O)Cn2nc3c(-c4nc(-c5ccc(Cl)cc5)no4)cccn3c2=O)C1 |
| InChI | InChI=1S/C22H21ClN6O3/c1-14-4-2-10-27(12-14)18(30)13-29-22(31)28-11-3-5-17(20(28)25-29)21-24-19(26-32-21)15-6-8-16(23)9-7-15/h3,5-9,11,14H,2,4,10,12-13H2,1H3/t14-/m1/s1 |
| InChIKey | DJHXMQBAVOHMAF-CQSZACIVSA-N |
| XLogP | 3.12 |
| TPSA | 98.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |