C13H15FN2S — CID 9420037
4-(3-fluorophenyl)-N-(2-methylpropyl)-1,3-thiazol-2-amine (PubChem CID 9420037) has the molecular formula C13H15FN2S and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-N-(2-methylpropyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(3-fluorophenyl)-N-(2-methylpropyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 9420037 |
| Molecular Formula | C13H15FN2S |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 4-(3-fluorophenyl)-N-(2-methylpropyl)-1,3-thiazol-2-amine |
| SMILES | CC(C)CNc1nc(-c2cccc(F)c2)cs1 |
| InChI | InChI=1S/C13H15FN2S/c1-9(2)7-15-13-16-12(8-17-13)10-4-3-5-11(14)6-10/h3-6,8-9H,7H2,1-2H3,(H,15,16) |
| InChIKey | GYWPVPNEGSDIAB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |