C11H17N3O4 — CID 94200554
(3S,6R)-6-methyl-1-[(1R,2S)-2-nitrocyclopropanecarbonyl]piperidine-3-carboxamide (PubChem CID 94200554) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is (3S,6R)-6-methyl-1-[(1R,2S)-2-nitrocyclopropanecarbonyl]piperidine-3-carboxamide.
| Compound Name | (3S,6R)-6-methyl-1-[(1R,2S)-2-nitrocyclopropanecarbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94200554 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | (3S,6R)-6-methyl-1-[(1R,2S)-2-nitrocyclopropanecarbonyl]piperidine-3-carboxamide |
| SMILES | C[C@@H]1CC[C@H](C(N)=O)CN1C(=O)[C@@H]1C[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C11H17N3O4/c1-6-2-3-7(10(12)15)5-13(6)11(16)8-4-9(8)14(17)18/h6-9H,2-5H2,1H3,(H2,12,15)/t6-,7+,8-,9+/m1/s1 |
| InChIKey | KJNJSRXSYXDJDO-XAVMHZPKSA-N |
| XLogP | -0.24 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|