About ethyl (2R)-2-[(2,5-dichlorothiophene-3-carbonyl)amino]propanoate
ethyl (2R)-2-[(2,5-dichlorothiophene-3-carbonyl)amino]propanoate (PubChem CID 94201025) has the molecular formula C10H11Cl2NO3S
and a molecular weight of 296.18 g/mol. Its IUPAC name is ethyl (2R)-2-[(2,5-dichlorothiophene-3-carbonyl)amino]propanoate.
Molecular Properties
| Compound Name | ethyl (2R)-2-[(2,5-dichlorothiophene-3-carbonyl)amino]propanoate |
| PubChem CID | 94201025 |
| Molecular Formula | C10H11Cl2NO3S |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | ethyl (2R)-2-[(2,5-dichlorothiophene-3-carbonyl)amino]propanoate |
| SMILES | CCOC(=O)[C@@H](C)NC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H11Cl2NO3S/c1-3-16-10(15)5(2)13-9(14)6-4-7(11)17-8(6)12/h4-5H,3H2,1-2H3,(H,13,14)/t5-/m1/s1 |
| InChIKey | YBLIITNFGJMZAH-RXMQYKEDSA-N |
| XLogP | 2.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (2R)-2-[(2,5-dichlorothiophene-3-carbonyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-[(2,5-dichlorothiophene-3-carbonyl)amino]propanoate?
The IUPAC name of ethyl (2R)-2-[(2,5-dichlorothiophene-3-carbonyl)amino]propanoate (CID 94201025) is ethyl (2R)-2-[(2,5-dichlorothiophene-3-carbonyl)amino]propanoate.
What is the SMILES notation for ethyl (2R)-2-[(2,5-dichlorothiophene-3-carbonyl)amino]propanoate?
The canonical SMILES for ethyl (2R)-2-[(2,5-dichlorothiophene-3-carbonyl)amino]propanoate is CCOC(=O)[C@@H](C)NC(=O)c1cc(Cl)sc1Cl.
What is the InChIKey of ethyl (2R)-2-[(2,5-dichlorothiophene-3-carbonyl)amino]propanoate?
The InChIKey is YBLIITNFGJMZAH-RXMQYKEDSA-N. The full InChI is InChI=1S/C10H11Cl2NO3S/c1-3-16-10(15)5(2)13-9(14)6-4-7(11)17-8(6)12/h4-5H,3H2,1-2H3,(H,13,14)/t5-/m1/s1.
What are the key properties of ethyl (2R)-2-[(2,5-dichlorothiophene-3-carbonyl)amino]propanoate?
ethyl (2R)-2-[(2,5-dichlorothiophene-3-carbonyl)amino]propanoate has a molecular weight of 296.18 g/mol, XLogP of 2.74, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-[(2,5-dichlorothiophene-3-carbonyl)amino]propanoate is sourced from PubChem (CID 94201025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).