C12H14N2O2S2 — CID 94202076
(2R)-N-[(5-nitrothiophen-3-yl)methyl]-1-thiophen-3-ylpropan-2-amine (PubChem CID 94202076) has the molecular formula C12H14N2O2S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is (2R)-N-[(5-nitrothiophen-3-yl)methyl]-1-thiophen-3-ylpropan-2-amine.
| Compound Name | (2R)-N-[(5-nitrothiophen-3-yl)methyl]-1-thiophen-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 94202076 |
| Molecular Formula | C12H14N2O2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | (2R)-N-[(5-nitrothiophen-3-yl)methyl]-1-thiophen-3-ylpropan-2-amine |
| SMILES | C[C@H](Cc1ccsc1)NCc1csc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14N2O2S2/c1-9(4-10-2-3-17-7-10)13-6-11-5-12(14(15)16)18-8-11/h2-3,5,7-9,13H,4,6H2,1H3/t9-/m1/s1 |
| InChIKey | RADSMJJXYWCMMY-SECBINFHSA-N |
| XLogP | 3.44 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|