C18H25N3OS — CID 9420248
(4aR,8aR)-1-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole (PubChem CID 9420248) has the molecular formula C18H25N3OS and a molecular weight of 331.49 g/mol. Its IUPAC name is (4aR,8aR)-1-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole.
| Compound Name | (4aR,8aR)-1-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole |
|---|---|
| PubChem CID | 9420248 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (4aR,8aR)-1-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole |
| SMILES | COCCn1c(C)cc(C2=CSC3=N[C@@H]4CCCC[C@H]4N23)c1C |
| InChI | InChI=1S/C18H25N3OS/c1-12-10-14(13(2)20(12)8-9-22-3)17-11-23-18-19-15-6-4-5-7-16(15)21(17)18/h10-11,15-16H,4-9H2,1-3H3/t15-,16-/m1/s1 |
| InChIKey | NZIJEXRPXUUBCO-HZPDHXFCSA-N |
| XLogP | 3.78 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |