C20H27N3O2S — CID 9420316
methyl 4-[3-[(4aR,8aR)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-2,5-dimethylpyrrol-1-yl]butanoate (PubChem CID 9420316) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is methyl 4-[3-[(4aR,8aR)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-2,5-dimethylpyrrol-1-yl]butanoate.
| Compound Name | methyl 4-[3-[(4aR,8aR)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-2,5-dimethylpyrrol-1-yl]butanoate |
|---|---|
| PubChem CID | 9420316 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | methyl 4-[3-[(4aR,8aR)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-2,5-dimethylpyrrol-1-yl]butanoate |
| SMILES | COC(=O)CCCn1c(C)cc(C2=CSC3=N[C@@H]4CCCC[C@H]4N23)c1C |
| InChI | InChI=1S/C20H27N3O2S/c1-13-11-15(14(2)22(13)10-6-9-19(24)25-3)18-12-26-20-21-16-7-4-5-8-17(16)23(18)20/h11-12,16-17H,4-10H2,1-3H3/t16-,17-/m1/s1 |
| InChIKey | SMBQRPNTORJAIV-IAGOWNOFSA-N |
| XLogP | 4.09 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |