C18H21N3OS — CID 9420426
N-[[4-[(4aS,8aS)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]phenyl]methyl]acetamide (PubChem CID 9420426) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is N-[[4-[(4aS,8aS)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]phenyl]methyl]acetamide.
| Compound Name | N-[[4-[(4aS,8aS)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 9420426 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-[[4-[(4aS,8aS)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(C2=CSC3=N[C@H]4CCCC[C@@H]4N23)cc1 |
| InChI | InChI=1S/C18H21N3OS/c1-12(22)19-10-13-6-8-14(9-7-13)17-11-23-18-20-15-4-2-3-5-16(15)21(17)18/h6-9,11,15-16H,2-5,10H2,1H3,(H,19,22)/t15-,16-/m0/s1 |
| InChIKey | XEMRPRNYOIMGOP-HOTGVXAUSA-N |
| XLogP | 3.35 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |