C18H23N3OS — CID 9420632
1-[5-[(4aS,8aS)-2-methyl-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-2,4-dimethyl-1H-pyrrol-3-yl]ethanone (PubChem CID 9420632) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is 1-[5-[(4aS,8aS)-2-methyl-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-2,4-dimethyl-1H-pyrrol-3-yl]ethanone.
| Compound Name | 1-[5-[(4aS,8aS)-2-methyl-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-2,4-dimethyl-1H-pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 9420632 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 1-[5-[(4aS,8aS)-2-methyl-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-2,4-dimethyl-1H-pyrrol-3-yl]ethanone |
| SMILES | CC(=O)c1c(C)[nH]c(C2=C(C)SC3=N[C@H]4CCCC[C@@H]4N32)c1C |
| InChI | InChI=1S/C18H23N3OS/c1-9-15(11(3)22)10(2)19-16(9)17-12(4)23-18-20-13-7-5-6-8-14(13)21(17)18/h13-14,19H,5-8H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | FHVGGGOKSBXDPB-KBPBESRZSA-N |
| XLogP | 4.25 |
| TPSA | 48.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |