C16H20N4O2S — CID 9421404
N-[2-hydroxy-5-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]phenyl]acetamide (PubChem CID 9421404) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-[2-hydroxy-5-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]phenyl]acetamide.
| Compound Name | N-[2-hydroxy-5-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 9421404 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[2-hydroxy-5-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(-c2csc(N3CCN(C)CC3)n2)ccc1O |
| InChI | InChI=1S/C16H20N4O2S/c1-11(21)17-13-9-12(3-4-15(13)22)14-10-23-16(18-14)20-7-5-19(2)6-8-20/h3-4,9-10,22H,5-8H2,1-2H3,(H,17,21) |
| InChIKey | CNZHPRRFDZBKLL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|