About 5-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]-1-methyl-3H-indol-2-one
5-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]-1-methyl-3H-indol-2-one (PubChem CID 9421508) has the molecular formula C20H18N2OS
and a molecular weight of 334.44 g/mol. Its IUPAC name is 5-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]-1-methyl-3H-indol-2-one.
Molecular Properties
| Compound Name | 5-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]-1-methyl-3H-indol-2-one |
| PubChem CID | 9421508 |
| Molecular Formula | C20H18N2OS |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 5-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]-1-methyl-3H-indol-2-one |
| SMILES | CCc1ccc(-c2nc(-c3ccc4c(c3)CC(=O)N4C)cs2)cc1 |
| InChI | InChI=1S/C20H18N2OS/c1-3-13-4-6-14(7-5-13)20-21-17(12-24-20)15-8-9-18-16(10-15)11-19(23)22(18)2/h4-10,12H,3,11H2,1-2H3 |
| InChIKey | UFRRTEFDSRMJIJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]-1-methyl-3H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]-1-methyl-3H-indol-2-one?
The IUPAC name of 5-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]-1-methyl-3H-indol-2-one (CID 9421508) is 5-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]-1-methyl-3H-indol-2-one.
What is the SMILES notation for 5-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]-1-methyl-3H-indol-2-one?
The canonical SMILES for 5-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]-1-methyl-3H-indol-2-one is CCc1ccc(-c2nc(-c3ccc4c(c3)CC(=O)N4C)cs2)cc1.
What is the InChIKey of 5-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]-1-methyl-3H-indol-2-one?
The InChIKey is UFRRTEFDSRMJIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2OS/c1-3-13-4-6-14(7-5-13)20-21-17(12-24-20)15-8-9-18-16(10-15)11-19(23)22(18)2/h4-10,12H,3,11H2,1-2H3.
What are the key properties of 5-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]-1-methyl-3H-indol-2-one?
5-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]-1-methyl-3H-indol-2-one has a molecular weight of 334.44 g/mol, XLogP of 4.56, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]-1-methyl-3H-indol-2-one is sourced from PubChem (CID 9421508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).