C18H18N6O — CID 94215476
(2S)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-[(1R)-cyclohex-3-en-1-yl]-3-oxopropanenitrile (PubChem CID 94215476) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is (2S)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-[(1R)-cyclohex-3-en-1-yl]-3-oxopropanenitrile.
| Compound Name | (2S)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-[(1R)-cyclohex-3-en-1-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 94215476 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (2S)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-[(1R)-cyclohex-3-en-1-yl]-3-oxopropanenitrile |
| SMILES | N#C[C@H](C(=O)[C@H]1CC=CCC1)c1nc(N)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C18H18N6O/c19-11-14(15(25)12-7-3-1-4-8-12)16-22-17(20)24-18(23-16)21-13-9-5-2-6-10-13/h1-3,5-6,9-10,12,14H,4,7-8H2,(H3,20,21,22,23,24)/t12-,14+/m0/s1 |
| InChIKey | CEFTWXOADVZPBM-GXTWGEPZSA-N |
| XLogP | 2.73 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|