About (2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide
(2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide (PubChem CID 94216385) has the molecular formula C14H15Cl2NO3
and a molecular weight of 316.18 g/mol. Its IUPAC name is (2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide |
| PubChem CID | 94216385 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | (2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide |
| SMILES | O=C(NC1(c2ccc(Cl)c(Cl)c2)CC1)[C@H]1COCCO1 |
| InChI | InChI=1S/C14H15Cl2NO3/c15-10-2-1-9(7-11(10)16)14(3-4-14)17-13(18)12-8-19-5-6-20-12/h1-2,7,12H,3-6,8H2,(H,17,18)/t12-/m1/s1 |
| InChIKey | WVXZZVDAATXPAO-GFCCVEGCSA-N |
| XLogP | 2.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide?
The IUPAC name of (2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide (CID 94216385) is (2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide.
What is the SMILES notation for (2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide?
The canonical SMILES for (2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide is O=C(NC1(c2ccc(Cl)c(Cl)c2)CC1)[C@H]1COCCO1.
What is the InChIKey of (2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide?
The InChIKey is WVXZZVDAATXPAO-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H15Cl2NO3/c15-10-2-1-9(7-11(10)16)14(3-4-14)17-13(18)12-8-19-5-6-20-12/h1-2,7,12H,3-6,8H2,(H,17,18)/t12-/m1/s1.
What are the key properties of (2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide?
(2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide has a molecular weight of 316.18 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide is sourced from PubChem (CID 94216385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).