C14H15Cl2NO3 — CID 94216385
(2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide (PubChem CID 94216385) has the molecular formula C14H15Cl2NO3 and a molecular weight of 316.18 g/mol. Its IUPAC name is (2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide.
| Compound Name | (2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 94216385 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | (2R)-N-[1-(3,4-dichlorophenyl)cyclopropyl]-1,4-dioxane-2-carboxamide |
| SMILES | O=C(NC1(c2ccc(Cl)c(Cl)c2)CC1)[C@H]1COCCO1 |
| InChI | InChI=1S/C14H15Cl2NO3/c15-10-2-1-9(7-11(10)16)14(3-4-14)17-13(18)12-8-19-5-6-20-12/h1-2,7,12H,3-6,8H2,(H,17,18)/t12-/m1/s1 |
| InChIKey | WVXZZVDAATXPAO-GFCCVEGCSA-N |
| XLogP | 2.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |